Products 1038334-99-4
CAS 1038334-99-4 is the registry number for 2-(4-(3-Methylbut-2-enamido)phenyl)acetic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-[4-(3-methylbut-2-enoylamino)phenyl]acetic acid (CAS 1038334-99-4) is a chemical compound with the molecular formula C13H15NO3 and a molecular weight of 233.26 g/mol. IUPAC name: 2-[4-(3-methylbut-2-enoylamino)phenyl]acetic acid. InChIKey: RRPPJKQGVAMRMU-UHFFFAOYSA-N.
| Molecular formula | C13H15NO3 |
|---|---|
| Molecular weight | 233.26 g/mol |
| IUPAC name | 2-[4-(3-methylbut-2-enoylamino)phenyl]acetic acid |
| InChIKey | RRPPJKQGVAMRMU-UHFFFAOYSA-N |
| SMILES | CC(=CC(=O)NC1=CC=C(C=C1)CC(=O)O)C |
Computed by PubChem (NCBI)