CAS 1038374-82-1 appears in our catalog under these names: 1-N-(2,4-Difluorophenyl)-4-fluorobenzene-1,2-diamine, 95%, 1-N-(2,4-Difluorophenyl)-4-fluorobenzene-1,2-diamine. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
1-N-(2,4-difluorophenyl)-4-fluorobenzene-1,2-diamine (CAS 1038374-82-1) is a chemical compound with the molecular formula C12H9F3N2 and a molecular weight of 238.21 g/mol. IUPAC name: 1-N-(2,4-difluorophenyl)-4-fluorobenzene-1,2-diamine. InChIKey: MRSONIDVJWSUHD-UHFFFAOYSA-N.
| Molecular formula | C12H9F3N2 |
|---|---|
| Molecular weight | 238.21 g/mol |
| IUPAC name | 1-N-(2,4-difluorophenyl)-4-fluorobenzene-1,2-diamine |
| InChIKey | MRSONIDVJWSUHD-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1F)N)NC2=C(C=C(C=C2)F)F |
Computed by PubChem (NCBI)