Products 1225829-49-1
CAS 1225829-49-1 is the registry number for 5-(4-(Trifluoromethyl)phenyl)pyridin-3-amine, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
5-[4-(trifluoromethyl)phenyl]pyridin-3-amine (CAS 1225829-49-1) is a chemical compound with the molecular formula C12H9F3N2 and a molecular weight of 238.21 g/mol. IUPAC name: 5-[4-(trifluoromethyl)phenyl]pyridin-3-amine. InChIKey: AKPBNZRYWFSCAI-UHFFFAOYSA-N.
| Molecular formula | C12H9F3N2 |
|---|---|
| Molecular weight | 238.21 g/mol |
| IUPAC name | 5-[4-(trifluoromethyl)phenyl]pyridin-3-amine |
| InChIKey | AKPBNZRYWFSCAI-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC(=CN=C2)N)C(F)(F)F |
Computed by PubChem (NCBI)