CAS 1038753-13-7 appears in our catalog under these names: 4'–O–Methyllicoflavanone, 4'-o-Methyllicoflavanone, Macatrichocarpin A. Offered by: GLPBio, Biosynth, MedChemExpress. Available pack sizes: 1mg, 10mg, 5mg, 25mg, 50mg, Get quote.
(2S)-5,7-dihydroxy-2-[4-methoxy-3-(3-methylbut-2-enyl)phenyl]-2,3-dihydrochromen-4-one (CAS 1038753-13-7) is a chemical compound with the molecular formula C21H22O5 and a molecular weight of 354.4 g/mol. IUPAC name: (2S)-5,7-dihydroxy-2-[4-methoxy-3-(3-methylbut-2-enyl)phenyl]-2,3-dihydrochromen-4-one. InChIKey: OSVQFBUNCMAMER-IBGZPJMESA-N.
| Molecular formula | C21H22O5 |
|---|---|
| Molecular weight | 354.4 g/mol |
| IUPAC name | (2S)-5,7-dihydroxy-2-[4-methoxy-3-(3-methylbut-2-enyl)phenyl]-2,3-dihydrochromen-4-one |
| InChIKey | OSVQFBUNCMAMER-IBGZPJMESA-N |
| SMILES | CC(=CCC1=C(C=CC(=C1)[C@@H]2CC(=O)C3=C(C=C(C=C3O2)O)O)OC)C |
Computed by PubChem (NCBI)