CAS 103882-85-5 appears in our catalog under these names: 4-Amino-1-((4S,5R)-3,3-difluoro-4-hydroxy-5-(hydroxymethyl)tetrahydrofuran-2-yl)pyrimidin-2(1H)-one, 98%, Gemcitabine Impurity 12, 3'-Epi Gemcitabine, Gemcitabine Impurity 4(Gemcitabine 3-Epimer), 3’-Epi Gemcitabine. Offered by: Chemat Brand, Hubei YoungXin, TRC, Biosynth. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 0,5mg, 1mg.
4-amino-1-[(4S,5R)-3,3-difluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidin-2-one (CAS 103882-85-5) is a chemical compound with the molecular formula C9H11F2N3O4 and a molecular weight of 263.20 g/mol. IUPAC name: 4-amino-1-[(4S,5R)-3,3-difluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidin-2-one. InChIKey: SDUQYLNIPVEERB-NKCGXFSVSA-N.
| Molecular formula | C9H11F2N3O4 |
|---|---|
| Molecular weight | 263.20 g/mol |
| IUPAC name | 4-amino-1-[(4S,5R)-3,3-difluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidin-2-one |
| InChIKey | SDUQYLNIPVEERB-NKCGXFSVSA-N |
| SMILES | C1=CN(C(=O)N=C1N)C2C([C@H]([C@H](O2)CO)O)(F)F |
Computed by PubChem (NCBI)