CAS 103884-20-4 is the registry number for 2,5-Diamino-6-nitro-4(3h)-quinazolinone, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
2,5-diamino-6-nitro-3H-quinazolin-4-one (CAS 103884-20-4) is a chemical compound with the molecular formula C8H7N5O3 and a molecular weight of 221.17 g/mol. IUPAC name: 2,5-diamino-6-nitro-3H-quinazolin-4-one. InChIKey: PCEUTCIRTZCFPY-UHFFFAOYSA-N.
| Molecular formula | C8H7N5O3 |
|---|---|
| Molecular weight | 221.17 g/mol |
| IUPAC name | 2,5-diamino-6-nitro-3H-quinazolin-4-one |
| InChIKey | PCEUTCIRTZCFPY-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C2=C1N=C(NC2=O)N)N)[N+](=O)[O-] |
Computed by PubChem (NCBI)