CAS 438212-42-1 is the registry number for N-([1,2,4]Triazolo[1,5-a]pyrimidin-2-ylcarbonyl)glycine, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
2-([1,2,4]triazolo[1,5-a]pyrimidine-2-carbonylamino)acetic acid (CAS 438212-42-1) is a chemical compound with the molecular formula C8H7N5O3 and a molecular weight of 221.17 g/mol. IUPAC name: 2-([1,2,4]triazolo[1,5-a]pyrimidine-2-carbonylamino)acetic acid. InChIKey: OPVKAJXZPPRJFN-UHFFFAOYSA-N.
| Molecular formula | C8H7N5O3 |
|---|---|
| Molecular weight | 221.17 g/mol |
| IUPAC name | 2-([1,2,4]triazolo[1,5-a]pyrimidine-2-carbonylamino)acetic acid |
| InChIKey | OPVKAJXZPPRJFN-UHFFFAOYSA-N |
| SMILES | C1=CN2C(=NC(=N2)C(=O)NCC(=O)O)N=C1 |
Computed by PubChem (NCBI)