Products 1038919-63-9
CAS 1038919-63-9 appears in our catalog under these names: (R)-5-Bromo-2,3-dihydro-1h-inden-1-ol, 97%, (R)-5-Bromo-2,3-dihydro-1H-inden-1-ol, 98+%, 98+%. Offered by: Combi-blocks, Chemat. Available pack sizes: 1g, 5g, 250mg, 100mg.
(1R)-5-bromo-2,3-dihydro-1H-inden-1-ol (CAS 1038919-63-9) is a chemical compound with the molecular formula C9H9BrO and a molecular weight of 213.07 g/mol. IUPAC name: (1R)-5-bromo-2,3-dihydro-1H-inden-1-ol. InChIKey: DRXIUUZVRAOHBS-SECBINFHSA-N.
| Molecular formula | C9H9BrO |
|---|---|
| Molecular weight | 213.07 g/mol |
| IUPAC name | (1R)-5-bromo-2,3-dihydro-1H-inden-1-ol |
| InChIKey | DRXIUUZVRAOHBS-SECBINFHSA-N |
| SMILES | C1CC2=C([C@@H]1O)C=CC(=C2)Br |
Computed by PubChem (NCBI)