CAS 1270284-15-5 appears in our catalog under these names: (1S)-5-Bromoindan-1-ol, 97%, (S)-5-Bromo-2,3-dihydro-1H-inden-1-ol, 98%, (S)-5-Bromo-2,3-dihydro-1H-inden-1-ol, 98%, 98%. Offered by: Combi-blocks, AmBeed, Chemat. Available pack sizes: 10g, 1g, 5g, 250mg, 100mg.
(1S)-5-bromo-2,3-dihydro-1H-inden-1-ol (CAS 1270284-15-5) is a chemical compound with the molecular formula C9H9BrO and a molecular weight of 213.07 g/mol. IUPAC name: (1S)-5-bromo-2,3-dihydro-1H-inden-1-ol. InChIKey: DRXIUUZVRAOHBS-VIFPVBQESA-N.
| Molecular formula | C9H9BrO |
|---|---|
| Molecular weight | 213.07 g/mol |
| IUPAC name | (1S)-5-bromo-2,3-dihydro-1H-inden-1-ol |
| InChIKey | DRXIUUZVRAOHBS-VIFPVBQESA-N |
| SMILES | C1CC2=C([C@H]1O)C=CC(=C2)Br |
Computed by PubChem (NCBI)