CAS 1038924-97-8 appears in our catalog under these names: 2,5-Dioxopyrrolidine Sacubitril, 97%, 97%, Sacubitril Impurity 2, Valsartan Impurity 40, Valsartan Impurity 77, Sacubitril Impurity 24. Offered by: Chemat, Chemat Brand, Hubei YoungXin, TRC, Biosynth. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 250mg, on request, 200mg, 5mg.
Ethyl (2R,4S)-4-(2,5-dioxopyrrolidin-1-yl)-2-methyl-5-(4-phenylphenyl)pentanoate (CAS 1038924-97-8) is a chemical compound with the molecular formula C24H27NO4 and a molecular weight of 393.5 g/mol. IUPAC name: ethyl (2R,4S)-4-(2,5-dioxopyrrolidin-1-yl)-2-methyl-5-(4-phenylphenyl)pentanoate. InChIKey: UXCICAHPGZDADX-UTKZUKDTSA-N.
| Molecular formula | C24H27NO4 |
|---|---|
| Molecular weight | 393.5 g/mol |
| IUPAC name | ethyl (2R,4S)-4-(2,5-dioxopyrrolidin-1-yl)-2-methyl-5-(4-phenylphenyl)pentanoate |
| InChIKey | UXCICAHPGZDADX-UTKZUKDTSA-N |
| SMILES | CCOC(=O)[C@H](C)C[C@@H](CC1=CC=C(C=C1)C2=CC=CC=C2)N3C(=O)CCC3=O |
Computed by PubChem (NCBI)