Products 1038966-53-8
CAS 1038966-53-8 is the registry number for (4-(2-Fluorophenoxy)phenyl)methanol. Offered by: Biosynth. Available pack sizes: 5g, 0,5g.
[4-(2-fluorophenoxy)phenyl]methanol (CAS 1038966-53-8) is a chemical compound with the molecular formula C13H11FO2 and a molecular weight of 218.22 g/mol. IUPAC name: [4-(2-fluorophenoxy)phenyl]methanol. InChIKey: OSONGMZAQFAPES-UHFFFAOYSA-N.
| Molecular formula | C13H11FO2 |
|---|---|
| Molecular weight | 218.22 g/mol |
| IUPAC name | [4-(2-fluorophenoxy)phenyl]methanol |
| InChIKey | OSONGMZAQFAPES-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)OC2=CC=C(C=C2)CO)F |
Computed by PubChem (NCBI)