CAS 1039102-11-8 appears in our catalog under these names: H-Beta,beta-dimethyl-l-cys(pmebzl)-oh, 95%, (R)-2-Amino-3-methyl-3-((4-methylbenzyl)thio)butanoic acid, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 5g, 25g, 1g.
(2R)-2-amino-3-methyl-3-[(4-methylphenyl)methylsulfanyl]butanoic acid (CAS 1039102-11-8) is a chemical compound with the molecular formula C13H19NO2S and a molecular weight of 253.36 g/mol. IUPAC name: (2R)-2-amino-3-methyl-3-[(4-methylphenyl)methylsulfanyl]butanoic acid. InChIKey: RXGXZBVIVDNKTB-LLVKDONJSA-N.
| Molecular formula | C13H19NO2S |
|---|---|
| Molecular weight | 253.36 g/mol |
| IUPAC name | (2R)-2-amino-3-methyl-3-[(4-methylphenyl)methylsulfanyl]butanoic acid |
| InChIKey | RXGXZBVIVDNKTB-LLVKDONJSA-N |
| SMILES | CC1=CC=C(C=C1)CSC(C)(C)[C@@H](C(=O)O)N |
Computed by PubChem (NCBI)