Products 1304343-74-5
CAS 1304343-74-5 is the registry number for 4-Cyclohexylmethanesulfonylaniline, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
4-(cyclohexylmethylsulfonyl)aniline (CAS 1304343-74-5) is a chemical compound with the molecular formula C13H19NO2S and a molecular weight of 253.36 g/mol. IUPAC name: 4-(cyclohexylmethylsulfonyl)aniline. InChIKey: HEKRUOXKHNPVHF-UHFFFAOYSA-N.
| Molecular formula | C13H19NO2S |
|---|---|
| Molecular weight | 253.36 g/mol |
| IUPAC name | 4-(cyclohexylmethylsulfonyl)aniline |
| InChIKey | HEKRUOXKHNPVHF-UHFFFAOYSA-N |
| SMILES | C1CCC(CC1)CS(=O)(=O)C2=CC=C(C=C2)N |
Computed by PubChem (NCBI)