CAS 103929-83-5 is the registry number for Methyl 3,5-bis(3-(tert-butyl)-1,1-dimethyldisiloxanyl)benzoate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 3,5-bis[[tert-butyl(dimethyl)silyl]oxy]benzoate (CAS 103929-83-5) is a chemical compound with the molecular formula C20H36O4Si2 and a molecular weight of 396.7 g/mol. IUPAC name: methyl 3,5-bis[[tert-butyl(dimethyl)silyl]oxy]benzoate. InChIKey: ODCVCBLUFQCUHW-UHFFFAOYSA-N.
| Molecular formula | C20H36O4Si2 |
|---|---|
| Molecular weight | 396.7 g/mol |
| IUPAC name | methyl 3,5-bis[[tert-butyl(dimethyl)silyl]oxy]benzoate |
| InChIKey | ODCVCBLUFQCUHW-UHFFFAOYSA-N |
| SMILES | CC(C)(C)[Si](C)(C)OC1=CC(=CC(=C1)C(=O)OC)O[Si](C)(C)C(C)(C)C |
Computed by PubChem (NCBI)