CAS 108956-90-7 is the registry number for 1-(2,4-Bis(((1,1-dimethylethyl)dimethylsilyl)oxy)-6-hydroxyphenyl)ethanone. Offered by: TRC. Available pack sizes: 5g.
1-[2,4-bis[[tert-butyl(dimethyl)silyl]oxy]-6-hydroxyphenyl]ethanone (CAS 108956-90-7) is a chemical compound with the molecular formula C20H36O4Si2 and a molecular weight of 396.7 g/mol. IUPAC name: 1-[2,4-bis[[tert-butyl(dimethyl)silyl]oxy]-6-hydroxyphenyl]ethanone. InChIKey: VSEXTNRATPGFEF-UHFFFAOYSA-N.
| Molecular formula | C20H36O4Si2 |
|---|---|
| Molecular weight | 396.7 g/mol |
| IUPAC name | 1-[2,4-bis[[tert-butyl(dimethyl)silyl]oxy]-6-hydroxyphenyl]ethanone |
| InChIKey | VSEXTNRATPGFEF-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=C(C=C(C=C1O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)O |
Computed by PubChem (NCBI)