Products 103962-06-7
CAS 103962-06-7 is the registry number for 3-(4-(Trifluoromethoxy)phenyl)prop-2-enenitrile. Offered by: Biosynth. Available pack sizes: 0,5g, 0,05g.
(E)-3-[4-(trifluoromethoxy)phenyl]prop-2-enenitrile (CAS 103962-06-7) is a chemical compound with the molecular formula C10H6F3NO and a molecular weight of 213.16 g/mol. IUPAC name: (E)-3-[4-(trifluoromethoxy)phenyl]prop-2-enenitrile. InChIKey: WZUSKVBYPYISLI-OWOJBTEDSA-N.
| Molecular formula | C10H6F3NO |
|---|---|
| Molecular weight | 213.16 g/mol |
| IUPAC name | (E)-3-[4-(trifluoromethoxy)phenyl]prop-2-enenitrile |
| InChIKey | WZUSKVBYPYISLI-OWOJBTEDSA-N |
| SMILES | C1=CC(=CC=C1/C=C/C#N)OC(F)(F)F |
Computed by PubChem (NCBI)