CAS 1039884-88-2 is the registry number for 4-(2,2,2-Trifluoroethoxy)-1,3-benzothiazol-2-amine. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
4-(2,2,2-trifluoroethoxy)-1,3-benzothiazol-2-amine (CAS 1039884-88-2) is a chemical compound with the molecular formula C9H7F3N2OS and a molecular weight of 248.23 g/mol. IUPAC name: 4-(2,2,2-trifluoroethoxy)-1,3-benzothiazol-2-amine. InChIKey: MWKAAIQKVGOALA-UHFFFAOYSA-N.
| Molecular formula | C9H7F3N2OS |
|---|---|
| Molecular weight | 248.23 g/mol |
| IUPAC name | 4-(2,2,2-trifluoroethoxy)-1,3-benzothiazol-2-amine |
| InChIKey | MWKAAIQKVGOALA-UHFFFAOYSA-N |
| SMILES | C1=CC(=C2C(=C1)SC(=N2)N)OCC(F)(F)F |
Computed by PubChem (NCBI)