CAS 131395-08-9 appears in our catalog under these names: 6-(2,2,2-Trifluoroethoxy)-1,3-benzothiazol-2-amine, 95%, 6-(2,2,2-Trifluoroethoxy)-1,3-benzothiazol-2-amine. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
6-(2,2,2-trifluoroethoxy)-1,3-benzothiazol-2-amine (CAS 131395-08-9) is a chemical compound with the molecular formula C9H7F3N2OS and a molecular weight of 248.23 g/mol. IUPAC name: 6-(2,2,2-trifluoroethoxy)-1,3-benzothiazol-2-amine. InChIKey: AUASPYTYDDWIAM-UHFFFAOYSA-N.
| Molecular formula | C9H7F3N2OS |
|---|---|
| Molecular weight | 248.23 g/mol |
| IUPAC name | 6-(2,2,2-trifluoroethoxy)-1,3-benzothiazol-2-amine |
| InChIKey | AUASPYTYDDWIAM-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1OCC(F)(F)F)SC(=N2)N |
Computed by PubChem (NCBI)