Products 1039945-17-9

CAS 1039945-17-9 is the registry number for 3-{((6-Methylcyclohex-3-en-1-yl)methoxy)methyl}benzoic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

3-[(6-methylcyclohex-3-en-1-yl)methoxymethyl]benzoic acid (CAS 1039945-17-9) is a chemical compound with the molecular formula C16H20O3 and a molecular weight of 260.33 g/mol. IUPAC name: 3-[(6-methylcyclohex-3-en-1-yl)methoxymethyl]benzoic acid. InChIKey: XXFBBSJHZMRSHZ-UHFFFAOYSA-N.

Identity
Molecular formulaC16H20O3
Molecular weight260.33 g/mol
IUPAC name3-[(6-methylcyclohex-3-en-1-yl)methoxymethyl]benzoic acid
InChIKeyXXFBBSJHZMRSHZ-UHFFFAOYSA-N
SMILESCC1CC=CCC1COCC2=CC(=CC=C2)C(=O)O

Computed by PubChem (NCBI)