Products 88010-62-2
CAS 88010-62-2 is the registry number for 2-Methoxyfuranoguaia-9-Ene-8-One. Offered by: Chemat Brand, Biosynth, MedChemExpress. Available pack sizes: on request, 50mg, 25mg, Get quote.
7-methoxy-3,6,9-trimethyl-7,8,9,9a-tetrahydro-6aH-azuleno[4,5-b]furan-4-one (CAS 88010-62-2) is a chemical compound with the molecular formula C16H20O3 and a molecular weight of 260.33 g/mol. IUPAC name: 7-methoxy-3,6,9-trimethyl-7,8,9,9a-tetrahydro-6aH-azuleno[4,5-b]furan-4-one. InChIKey: CRFQMYMTPWUTGB-UHFFFAOYSA-N.
| Molecular formula | C16H20O3 |
|---|---|
| Molecular weight | 260.33 g/mol |
| IUPAC name | 7-methoxy-3,6,9-trimethyl-7,8,9,9a-tetrahydro-6aH-azuleno[4,5-b]furan-4-one |
| InChIKey | CRFQMYMTPWUTGB-UHFFFAOYSA-N |
| SMILES | CC1CC(C2C1C3=C(C(=CO3)C)C(=O)C=C2C)OC |
Computed by PubChem (NCBI)