CAS 1039960-60-5 is the registry number for (5-Fluoro-2-methoxyphenyl)(3-methoxyphenyl)methanamine. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
(5-fluoro-2-methoxyphenyl)-(3-methoxyphenyl)methanamine (CAS 1039960-60-5) is a chemical compound with the molecular formula C15H16FNO2 and a molecular weight of 261.29 g/mol. IUPAC name: (5-fluoro-2-methoxyphenyl)-(3-methoxyphenyl)methanamine. InChIKey: NNHAEUSIHKMPTF-UHFFFAOYSA-N.
| Molecular formula | C15H16FNO2 |
|---|---|
| Molecular weight | 261.29 g/mol |
| IUPAC name | (5-fluoro-2-methoxyphenyl)-(3-methoxyphenyl)methanamine |
| InChIKey | NNHAEUSIHKMPTF-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)F)C(C2=CC(=CC=C2)OC)N |
Computed by PubChem (NCBI)