CAS 370853-51-3 is the registry number for 2-[(2-Fluoroanilino)methylene]-5,5-dimethyl-1,3-cyclohexanedione, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
2-[(2-fluorophenyl)iminomethyl]-3-hydroxy-5,5-dimethylcyclohex-2-en-1-one (CAS 370853-51-3) is a chemical compound with the molecular formula C15H16FNO2 and a molecular weight of 261.29 g/mol. IUPAC name: 2-[(2-fluorophenyl)iminomethyl]-3-hydroxy-5,5-dimethylcyclohex-2-en-1-one. InChIKey: RBWQVLSEYXHJRF-UHFFFAOYSA-N.
| Molecular formula | C15H16FNO2 |
|---|---|
| Molecular weight | 261.29 g/mol |
| IUPAC name | 2-[(2-fluorophenyl)iminomethyl]-3-hydroxy-5,5-dimethylcyclohex-2-en-1-one |
| InChIKey | RBWQVLSEYXHJRF-UHFFFAOYSA-N |
| SMILES | CC1(CC(=C(C(=O)C1)C=NC2=CC=CC=C2F)O)C |
Computed by PubChem (NCBI)