Products 1039984-70-7
CAS 1039984-70-7 is the registry number for N-(2-Chloro-4-methylphenyl)-4-hydroxybenzamide, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
N-(2-chloro-4-methylphenyl)-4-hydroxybenzamide (CAS 1039984-70-7) is a chemical compound with the molecular formula C14H12ClNO2 and a molecular weight of 261.70 g/mol. IUPAC name: N-(2-chloro-4-methylphenyl)-4-hydroxybenzamide. InChIKey: OZCKMUSJRXYFBT-UHFFFAOYSA-N.
| Molecular formula | C14H12ClNO2 |
|---|---|
| Molecular weight | 261.70 g/mol |
| IUPAC name | N-(2-chloro-4-methylphenyl)-4-hydroxybenzamide |
| InChIKey | OZCKMUSJRXYFBT-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)NC(=O)C2=CC=C(C=C2)O)Cl |
Computed by PubChem (NCBI)