CAS 91713-54-1 appears in our catalog under these names: (2-Amino-5-methoxyphenyl)(4-chlorophenyl)methanone, 95%, (2-Amino-5-(methyloxy)phenyl)(4-chlorophenyl)methanone, (2–AMino–5–(Methyloxy)phenyl)(4–chlorophenyl)Methanone. Offered by: Combi-blocks, TRC, GLPBio. Available pack sizes: 1g, 250mg, 5g, 100mg.
(2-amino-5-methoxyphenyl)-(4-chlorophenyl)methanone (CAS 91713-54-1) is a chemical compound with the molecular formula C14H12ClNO2 and a molecular weight of 261.70 g/mol. IUPAC name: (2-amino-5-methoxyphenyl)-(4-chlorophenyl)methanone. InChIKey: MIQUXYBYLZSOIJ-UHFFFAOYSA-N.
| Molecular formula | C14H12ClNO2 |
|---|---|
| Molecular weight | 261.70 g/mol |
| IUPAC name | (2-amino-5-methoxyphenyl)-(4-chlorophenyl)methanone |
| InChIKey | MIQUXYBYLZSOIJ-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1)N)C(=O)C2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)