Products 1039993-93-5

CAS 1039993-93-5 is the registry number for 2,6-Difluoro-3-(methylsulfamoyl)benzoic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

2,6-difluoro-3-(methylsulfamoyl)benzoic acid (CAS 1039993-93-5) is a chemical compound with the molecular formula C8H7F2NO4S and a molecular weight of 251.21 g/mol. IUPAC name: 2,6-difluoro-3-(methylsulfamoyl)benzoic acid. InChIKey: XEJQTMPTFBEQLE-UHFFFAOYSA-N.

Identity
Molecular formulaC8H7F2NO4S
Molecular weight251.21 g/mol
IUPAC name2,6-difluoro-3-(methylsulfamoyl)benzoic acid
InChIKeyXEJQTMPTFBEQLE-UHFFFAOYSA-N
SMILESCNS(=O)(=O)C1=C(C(=C(C=C1)F)C(=O)O)F

Computed by PubChem (NCBI)