CAS 731003-82-0 appears in our catalog under these names: ([(2,6-Difluorophenyl)sulfonyl]amino)acetic acid, 95%, {((2,6-difluorophenyl)sulfonyl)amino}acetic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 1g, 5g, 250mg.
2-[(2,6-difluorophenyl)sulfonylamino]acetic acid (CAS 731003-82-0) is a chemical compound with the molecular formula C8H7F2NO4S and a molecular weight of 251.21 g/mol. IUPAC name: 2-[(2,6-difluorophenyl)sulfonylamino]acetic acid. InChIKey: MSHZFLDBUGYYJF-UHFFFAOYSA-N.
| Molecular formula | C8H7F2NO4S |
|---|---|
| Molecular weight | 251.21 g/mol |
| IUPAC name | 2-[(2,6-difluorophenyl)sulfonylamino]acetic acid |
| InChIKey | MSHZFLDBUGYYJF-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)F)S(=O)(=O)NCC(=O)O)F |
Computed by PubChem (NCBI)