CAS 1040042-49-6 is the registry number for 1-N-Isopropyl-3-(trifluoromethyl)benzene-1,4-diamine, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
4-N-propan-2-yl-2-(trifluoromethyl)benzene-1,4-diamine (CAS 1040042-49-6) is a chemical compound with the molecular formula C10H13F3N2 and a molecular weight of 218.22 g/mol. IUPAC name: 4-N-propan-2-yl-2-(trifluoromethyl)benzene-1,4-diamine. InChIKey: HRNSVYAVRBWUDX-UHFFFAOYSA-N.
| Molecular formula | C10H13F3N2 |
|---|---|
| Molecular weight | 218.22 g/mol |
| IUPAC name | 4-N-propan-2-yl-2-(trifluoromethyl)benzene-1,4-diamine |
| InChIKey | HRNSVYAVRBWUDX-UHFFFAOYSA-N |
| SMILES | CC(C)NC1=CC(=C(C=C1)N)C(F)(F)F |
Computed by PubChem (NCBI)