CAS 1240529-39-8 is the registry number for 1,1,1-Trifluoro-4-phenylbutane-2,3-diamine. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
1,1,1-trifluoro-4-phenylbutane-2,3-diamine (CAS 1240529-39-8) is a chemical compound with the molecular formula C10H13F3N2 and a molecular weight of 218.22 g/mol. IUPAC name: 1,1,1-trifluoro-4-phenylbutane-2,3-diamine. InChIKey: QVVAVUSJVMSJQJ-UHFFFAOYSA-N.
| Molecular formula | C10H13F3N2 |
|---|---|
| Molecular weight | 218.22 g/mol |
| IUPAC name | 1,1,1-trifluoro-4-phenylbutane-2,3-diamine |
| InChIKey | QVVAVUSJVMSJQJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CC(C(C(F)(F)F)N)N |
Computed by PubChem (NCBI)