Products 1040081-91-1

CAS 1040081-91-1 is the registry number for 2-(4-Methyl-1,4-diazepan-1-yl)acetic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-(4-methyl-1,4-diazepan-1-yl)acetic acid (CAS 1040081-91-1) is a chemical compound with the molecular formula C8H16N2O2 and a molecular weight of 172.22 g/mol. IUPAC name: 2-(4-methyl-1,4-diazepan-1-yl)acetic acid. InChIKey: AFADJPINXSRBIF-UHFFFAOYSA-N.

Identity
Molecular formulaC8H16N2O2
Molecular weight172.22 g/mol
IUPAC name2-(4-methyl-1,4-diazepan-1-yl)acetic acid
InChIKeyAFADJPINXSRBIF-UHFFFAOYSA-N
SMILESCN1CCCN(CC1)CC(=O)O

Computed by PubChem (NCBI)