CAS 1040084-84-1 appears in our catalog under these names: 2-Chloro-1-N-(1-phenylethyl)benzene-1,4-diamine, 2-Chloro-1-N-(1-phenylethyl)benzene-1,4-diamine, 95%. Offered by: Biosynth, AmBeed. Available pack sizes: 250mg, 2,5g, 5g.
2-chloro-1-N-(1-phenylethyl)benzene-1,4-diamine (CAS 1040084-84-1) is a chemical compound with the molecular formula C14H15ClN2 and a molecular weight of 246.73 g/mol. IUPAC name: 2-chloro-1-N-(1-phenylethyl)benzene-1,4-diamine. InChIKey: CLZDEJWNOZKAPN-UHFFFAOYSA-N.
| Molecular formula | C14H15ClN2 |
|---|---|
| Molecular weight | 246.73 g/mol |
| IUPAC name | 2-chloro-1-N-(1-phenylethyl)benzene-1,4-diamine |
| InChIKey | CLZDEJWNOZKAPN-UHFFFAOYSA-N |
| SMILES | CC(C1=CC=CC=C1)NC2=C(C=C(C=C2)N)Cl |
Computed by PubChem (NCBI)