CAS 71971-47-6 is the registry number for 2-(2,3-Dihydro-1H-indol-1-yl)aniline hydrochloride, 95%. Offered by: AmBeed. Available pack sizes: 5g.
2-(2,3-dihydroindol-1-yl)aniline;hydrochloride (CAS 71971-47-6) is a chemical compound with the molecular formula C14H15ClN2 and a molecular weight of 246.73 g/mol. IUPAC name: 2-(2,3-dihydroindol-1-yl)aniline;hydrochloride. InChIKey: SMAKGAAQJRHRGV-UHFFFAOYSA-N.
| Molecular formula | C14H15ClN2 |
|---|---|
| Molecular weight | 246.73 g/mol |
| IUPAC name | 2-(2,3-dihydroindol-1-yl)aniline;hydrochloride |
| InChIKey | SMAKGAAQJRHRGV-UHFFFAOYSA-N |
| SMILES | C1CN(C2=CC=CC=C21)C3=CC=CC=C3N.Cl |
Computed by PubChem (NCBI)