CAS 104055-39-2 appears in our catalog under these names: Boc-aib-osu, 95%, Boc–Aib–OSu. Offered by: Combi-blocks, GLPBio. Available pack sizes: 5g, 1g.
Sulfo 2-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate (CAS 104055-39-2) is a chemical compound with the molecular formula C9H17NO7S and a molecular weight of 283.30 g/mol. IUPAC name: sulfo 2-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate. InChIKey: VKOCPCPAMXLHHZ-UHFFFAOYSA-N.
| Molecular formula | C9H17NO7S |
|---|---|
| Molecular weight | 283.30 g/mol |
| IUPAC name | sulfo 2-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
| InChIKey | VKOCPCPAMXLHHZ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC(C)(C)C(=O)OS(=O)(=O)O |
Computed by PubChem (NCBI)