CAS 232617-16-2 appears in our catalog under these names: L-Cysteine-D-Glucose Adduct, L-Cysteine D-glucose. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 25mg.
(4R)-2-[(1R,2S,3R,4R)-1,2,3,4,5-pentahydroxypentyl]-1,3-thiazolidine-4-carboxylic acid (CAS 232617-16-2) is a chemical compound with the molecular formula C9H17NO7S and a molecular weight of 283.30 g/mol. IUPAC name: (4R)-2-[(1R,2S,3R,4R)-1,2,3,4,5-pentahydroxypentyl]-1,3-thiazolidine-4-carboxylic acid. InChIKey: JEPVUMTVFPQKQE-DREIXADXSA-N.
| Molecular formula | C9H17NO7S |
|---|---|
| Molecular weight | 283.30 g/mol |
| IUPAC name | (4R)-2-[(1R,2S,3R,4R)-1,2,3,4,5-pentahydroxypentyl]-1,3-thiazolidine-4-carboxylic acid |
| InChIKey | JEPVUMTVFPQKQE-DREIXADXSA-N |
| SMILES | C1[C@H](NC(S1)[C@@H]([C@H]([C@@H]([C@@H](CO)O)O)O)O)C(=O)O |
Computed by PubChem (NCBI)