CAS 1041011-20-4 appears in our catalog under these names: Boc-L-Phe(4-OCF3)-OH, (S)-2-((tert-Butoxycarbonyl)amino)-3-(4-(trifluoromethoxy)phenyl)propanoic acid, 95%. Offered by: Iris Biotech, AmBeed. Available pack sizes: 1g, 50mg, 250mg, 100mg.
(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-[4-(trifluoromethoxy)phenyl]propanoic acid (CAS 1041011-20-4) is a chemical compound with the molecular formula C15H18F3NO5 and a molecular weight of 349.30 g/mol. IUPAC name: (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-[4-(trifluoromethoxy)phenyl]propanoic acid. InChIKey: CRGWDQAJLMVWNI-NSHDSACASA-N.
| Molecular formula | C15H18F3NO5 |
|---|---|
| Molecular weight | 349.30 g/mol |
| IUPAC name | (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-[4-(trifluoromethoxy)phenyl]propanoic acid |
| InChIKey | CRGWDQAJLMVWNI-NSHDSACASA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CC1=CC=C(C=C1)OC(F)(F)F)C(=O)O |
Computed by PubChem (NCBI)