CAS 1213920-25-2 is the registry number for N-Boc-3-trifluoromethoxy-D-phenylalanine, 97%. Offered by: AmBeed. Available pack sizes: 1g.
(2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-[3-(trifluoromethoxy)phenyl]propanoic acid (CAS 1213920-25-2) is a chemical compound with the molecular formula C15H18F3NO5 and a molecular weight of 349.30 g/mol. IUPAC name: (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-[3-(trifluoromethoxy)phenyl]propanoic acid. InChIKey: RMRFZVYLKTUKNA-LLVKDONJSA-N.
| Molecular formula | C15H18F3NO5 |
|---|---|
| Molecular weight | 349.30 g/mol |
| IUPAC name | (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-[3-(trifluoromethoxy)phenyl]propanoic acid |
| InChIKey | RMRFZVYLKTUKNA-LLVKDONJSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H](CC1=CC(=CC=C1)OC(F)(F)F)C(=O)O |
Computed by PubChem (NCBI)