CAS 1041026-61-2 appears in our catalog under these names: 3,3-Bis(bromomethyl)-1-(p-toluenesulfonyl)azetidine, 95%, 3,3-Bis(bromomethyl)-1-tosylazetidine, 97%, 3,3-Bis(bromomethyl)-1-(p-toluenesulfonyl)azetidine. Offered by: Combi-blocks, AmBeed, Biosynth, Fluorochem. Available pack sizes: 250mg, 1g, 10g, 5g, 2,5g, 100mg, 500mg.
3,3-bis(bromomethyl)-1-(4-methylphenyl)sulfonylazetidine (CAS 1041026-61-2) is a chemical compound with the molecular formula C12H15Br2NO2S and a molecular weight of 397.13 g/mol. IUPAC name: 3,3-bis(bromomethyl)-1-(4-methylphenyl)sulfonylazetidine. InChIKey: IOQDNRYTTAIWTH-UHFFFAOYSA-N.
| Molecular formula | C12H15Br2NO2S |
|---|---|
| Molecular weight | 397.13 g/mol |
| IUPAC name | 3,3-bis(bromomethyl)-1-(4-methylphenyl)sulfonylazetidine |
| InChIKey | IOQDNRYTTAIWTH-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)N2CC(C2)(CBr)CBr |
Computed by PubChem (NCBI)