CAS 1584716-48-2 is the registry number for tert-Butyl 2,3-dibromo-4,7-dihydrothieno[2,3-c]pyridine-6(5H)-carboxylate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl 2,3-dibromo-5,7-dihydro-4H-thieno[2,3-c]pyridine-6-carboxylate (CAS 1584716-48-2) is a chemical compound with the molecular formula C12H15Br2NO2S and a molecular weight of 397.13 g/mol. IUPAC name: tert-butyl 2,3-dibromo-5,7-dihydro-4H-thieno[2,3-c]pyridine-6-carboxylate. InChIKey: JEGXUNSBUSQZFI-UHFFFAOYSA-N.
| Molecular formula | C12H15Br2NO2S |
|---|---|
| Molecular weight | 397.13 g/mol |
| IUPAC name | tert-butyl 2,3-dibromo-5,7-dihydro-4H-thieno[2,3-c]pyridine-6-carboxylate |
| InChIKey | JEGXUNSBUSQZFI-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC2=C(C1)SC(=C2Br)Br |
Computed by PubChem (NCBI)