CAS 1041026-70-3 appears in our catalog under these names: 2–(tert–Butoxycarbonyl)–2,6–diazaspiro(3·3)heptane, tert-Butyl 2,6-diazaspiro[3.3]heptane-2-carboxylate, 96%, tert-Butyl 2,6-Diazaspiro(3.3)heptane-2-carboxylate, tert-Butyl 2,6-Diazaspiro[3.3]heptane-2-carboxylate, >98.0%(GC), tert-Butyl 2,6-Diazaspiro[3.3]heptane-2-carboxylate 95%. Offered by: GLPBio, Combi-blocks, TRC, TCI, Ambeed. Available pack sizes: 250mg, 50mg, 5g, 1g, 500mg, 200mg, 100g, 100mg.
Tert-butyl 2,6-diazaspiro[3.3]heptane-2-carboxylate (CAS 1041026-70-3) is a chemical compound with the molecular formula C10H18N2O2 and a molecular weight of 198.26 g/mol. IUPAC name: tert-butyl 2,6-diazaspiro[3.3]heptane-2-carboxylate. InChIKey: KVOUHLVOTMOJBS-UHFFFAOYSA-N.
| Molecular formula | C10H18N2O2 |
|---|---|
| Molecular weight | 198.26 g/mol |
| IUPAC name | tert-butyl 2,6-diazaspiro[3.3]heptane-2-carboxylate |
| InChIKey | KVOUHLVOTMOJBS-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC2(C1)CNC2 |
Computed by PubChem (NCBI)