Products 104127-76-6

CAS 104127-76-6 is the registry number for Allyl (triphenylphosphoranylidene)acetate. Offered by: Biosynth. Available pack sizes: 1g, 0,5g, 5g, 10g, 25g.

Structural formula: {0} (CAS {1})

Prop-2-enyl 2-(triphenyl-lambda5-phosphanylidene)acetate (CAS 104127-76-6) is a chemical compound with the molecular formula C23H21O2P and a molecular weight of 360.4 g/mol. IUPAC name: prop-2-enyl 2-(triphenyl-lambda5-phosphanylidene)acetate. InChIKey: JNQMUMNJRCNSAI-UHFFFAOYSA-N.

Identity
Molecular formulaC23H21O2P
Molecular weight360.4 g/mol
IUPAC nameprop-2-enyl 2-(triphenyl-lambda5-phosphanylidene)acetate
InChIKeyJNQMUMNJRCNSAI-UHFFFAOYSA-N
SMILESC=CCOC(=O)C=P(C1=CC=CC=C1)(C2=CC=CC=C2)C3=CC=CC=C3

Computed by PubChem (NCBI)