CAS 218282-19-0 is the registry number for 3-(Triphenylphosphoranylidene)tetrahydropyran-2-one, 97%. Offered by: Thermo Scientific (Acros). Available pack sizes: 1g.
3-(triphenyl-lambda5-phosphanylidene)oxan-2-one (CAS 218282-19-0) is a chemical compound with the molecular formula C23H21O2P and a molecular weight of 360.4 g/mol. IUPAC name: 3-(triphenyl-lambda5-phosphanylidene)oxan-2-one. InChIKey: PZGUKMFSICDTKX-UHFFFAOYSA-N.
| Molecular formula | C23H21O2P |
|---|---|
| Molecular weight | 360.4 g/mol |
| IUPAC name | 3-(triphenyl-lambda5-phosphanylidene)oxan-2-one |
| InChIKey | PZGUKMFSICDTKX-UHFFFAOYSA-N |
| SMILES | C1CC(=P(C2=CC=CC=C2)(C3=CC=CC=C3)C4=CC=CC=C4)C(=O)OC1 |
Computed by PubChem (NCBI)