CAS 104130-35-0 is the registry number for Iodobenzene-13C6. Offered by: TRC. Available pack sizes: 10mg.
Iodo(1,2,3,4,5,6-13C6)cyclohexatriene (CAS 104130-35-0) is a chemical compound with the molecular formula C6H5I and a molecular weight of 209.964 g/mol. IUPAC name: iodo(1,2,3,4,5,6-13C6)cyclohexatriene. InChIKey: SNHMUERNLJLMHN-IDEBNGHGSA-N.
| Molecular formula | C6H5I |
|---|---|
| Molecular weight | 209.964 g/mol |
| IUPAC name | iodo(1,2,3,4,5,6-13C6)cyclohexatriene |
| InChIKey | SNHMUERNLJLMHN-IDEBNGHGSA-N |
| SMILES | [13CH]1=[13CH][13CH]=[13C]([13CH]=[13CH]1)I |
Computed by PubChem (NCBI)