CAS 7379-67-1 appears in our catalog under these names: Iodobenzene-d5, 98%, Iodobenzene-d5, Iodobenzene-d5, 98 atom % D, min 98% Chemical Purity, IODOBENZENE-D5, 98+ ATOM % D, Iodobenzene-d5, 99.75%. Offered by: Combi-blocks, TRC, CDN, Sigma-Aldrich, MedChemExpress. Available pack sizes: 250mg, 1g, 5g, 10mg, 1mg, 2mg, 0,5g, 1 g.
1,2,3,4,5-pentadeuterio-6-iodobenzene (CAS 7379-67-1) is a chemical compound with the molecular formula C6H5I and a molecular weight of 209.04 g/mol. IUPAC name: 1,2,3,4,5-pentadeuterio-6-iodobenzene. InChIKey: SNHMUERNLJLMHN-RALIUCGRSA-N.
| Molecular formula | C6H5I |
|---|---|
| Molecular weight | 209.04 g/mol |
| IUPAC name | 1,2,3,4,5-pentadeuterio-6-iodobenzene |
| InChIKey | SNHMUERNLJLMHN-RALIUCGRSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])I)[2H])[2H] |
Computed by PubChem (NCBI)