CAS 1041424-77-4 appears in our catalog under these names: Trimethyl-(6-methylsulfonylsulfanylhexyl)azanium Bromide, N,N,N-Trimethyl-6-((methylsulfonyl)thio)hexan-1-aminium, 98%, (6-(Trimethylammonium)hexyl) Methanethiosulfonate Bromide. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 100mg, 10mg.
Trimethyl(6-methylsulfonylsulfanylhexyl)azanium bromide (CAS 1041424-77-4) is a chemical compound with the molecular formula C10H24BrNO2S2 and a molecular weight of 334.3 g/mol. IUPAC name: trimethyl(6-methylsulfonylsulfanylhexyl)azanium bromide. InChIKey: ZDCGBEOAIWDJBP-UHFFFAOYSA-M.
| Molecular formula | C10H24BrNO2S2 |
|---|---|
| Molecular weight | 334.3 g/mol |
| IUPAC name | trimethyl(6-methylsulfonylsulfanylhexyl)azanium bromide |
| InChIKey | ZDCGBEOAIWDJBP-UHFFFAOYSA-M |
| SMILES | C[N+](C)(C)CCCCCCSS(=O)(=O)C.[Br-] |
Computed by PubChem (NCBI)