CAS 219789-15-8 is the registry number for 3-(Triethylammonium)propyl Methanthiosulfonate Bromide. Offered by: TRC. Available pack sizes: 10mg, 25mg.
Triethyl(3-methylsulfonylsulfanylpropyl)azanium bromide (CAS 219789-15-8) is a chemical compound with the molecular formula C10H24BrNO2S2 and a molecular weight of 334.3 g/mol. IUPAC name: triethyl(3-methylsulfonylsulfanylpropyl)azanium bromide. InChIKey: HSMSYCCXSSOJQO-UHFFFAOYSA-M.
| Molecular formula | C10H24BrNO2S2 |
|---|---|
| Molecular weight | 334.3 g/mol |
| IUPAC name | triethyl(3-methylsulfonylsulfanylpropyl)azanium bromide |
| InChIKey | HSMSYCCXSSOJQO-UHFFFAOYSA-M |
| SMILES | CC[N+](CC)(CC)CCCSS(=O)(=O)C.[Br-] |
Computed by PubChem (NCBI)