Products 219789-15-8

CAS 219789-15-8 is the registry number for 3-(Triethylammonium)propyl Methanthiosulfonate Bromide. Offered by: TRC. Available pack sizes: 10mg, 25mg.

Structural formula: {0} (CAS {1})

Triethyl(3-methylsulfonylsulfanylpropyl)azanium bromide (CAS 219789-15-8) is a chemical compound with the molecular formula C10H24BrNO2S2 and a molecular weight of 334.3 g/mol. IUPAC name: triethyl(3-methylsulfonylsulfanylpropyl)azanium bromide. InChIKey: HSMSYCCXSSOJQO-UHFFFAOYSA-M.

Identity
Molecular formulaC10H24BrNO2S2
Molecular weight334.3 g/mol
IUPAC nametriethyl(3-methylsulfonylsulfanylpropyl)azanium bromide
InChIKeyHSMSYCCXSSOJQO-UHFFFAOYSA-M
SMILESCC[N+](CC)(CC)CCCSS(=O)(=O)C.[Br-]

Computed by PubChem (NCBI)