Products 1041514-31-1
CAS 1041514-31-1 appears in our catalog under these names: 4-(4-(2-Methylpropyl)phenyl)butanoic acid, 4-(4-Isobutylphenyl)butanoic acid, 95%, 95%, 4-[4-(2-methylpropyl)phenyl]butanoic acid, 95%, 4-(4-Isobutylphenyl)butanoic acid, 95%. Offered by: Biosynth, Chemat, Fluorochem, Ambeed. Available pack sizes: 250mg, 2,5g, 100mg, 1g, 5g.
4-[4-(2-methylpropyl)phenyl]butanoic acid (CAS 1041514-31-1) is a chemical compound with the molecular formula C14H20O2 and a molecular weight of 220.31 g/mol. IUPAC name: 4-[4-(2-methylpropyl)phenyl]butanoic acid. InChIKey: BIQFDSJVVFHEED-UHFFFAOYSA-N.
| Molecular formula | C14H20O2 |
|---|---|
| Molecular weight | 220.31 g/mol |
| IUPAC name | 4-[4-(2-methylpropyl)phenyl]butanoic acid |
| InChIKey | BIQFDSJVVFHEED-UHFFFAOYSA-N |
| SMILES | CC(C)CC1=CC=C(C=C1)CCCC(=O)O |
Computed by PubChem (NCBI)