CAS 1041576-35-5 is the registry number for 3-Cyclopropyl-5-(2-pyrrolidinyl)-1,2,4-oxadiazole, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg, 100mg.
3-cyclopropyl-5-pyrrolidin-2-yl-1,2,4-oxadiazole (CAS 1041576-35-5) is a chemical compound with the molecular formula C9H13N3O and a molecular weight of 179.22 g/mol. IUPAC name: 3-cyclopropyl-5-pyrrolidin-2-yl-1,2,4-oxadiazole. InChIKey: XXKINXALESACRW-UHFFFAOYSA-N.
| Molecular formula | C9H13N3O |
|---|---|
| Molecular weight | 179.22 g/mol |
| IUPAC name | 3-cyclopropyl-5-pyrrolidin-2-yl-1,2,4-oxadiazole |
| InChIKey | XXKINXALESACRW-UHFFFAOYSA-N |
| SMILES | C1CC(NC1)C2=NC(=NO2)C3CC3 |
Computed by PubChem (NCBI)