CAS 104162-48-3 appears in our catalog under these names: N-(1-(2,3-Dioleyloxy)propyl)-N,N,N-trimethylammonium Chloride, N–(1–(2,3–Dioleyloxy)propyl)–N,N,N–trimethylammonium (chloride), Trimethyl[2,3-(dioleyloxy)propyl]ammonium chloride 95%, Trimethyl[2,3-(dioleyloxy)propyl]ammonium (chloride), 99.72%, DOTMA, 95%. Offered by: Chemat Brand, GLPBio, Ambeed, MedChemExpress, Fluorochem. Available pack sizes: on request, 100mg, 50mg, 250mg, 1g, 100 mg, 50 mg.
2,3-bis[(Z)-octadec-9-enoxy]propyl-trimethylazanium chloride (CAS 104162-48-3) is a chemical compound with the molecular formula C42H84ClNO2 and a molecular weight of 670.6 g/mol. IUPAC name: 2,3-bis[(Z)-octadec-9-enoxy]propyl-trimethylazanium chloride. InChIKey: LDGWQMRUWMSZIU-LQDDAWAPSA-M.
| Molecular formula | C42H84ClNO2 |
|---|---|
| Molecular weight | 670.6 g/mol |
| IUPAC name | 2,3-bis[(Z)-octadec-9-enoxy]propyl-trimethylazanium chloride |
| InChIKey | LDGWQMRUWMSZIU-LQDDAWAPSA-M |
| SMILES | CCCCCCCC/C=C\CCCCCCCCOCC(C[N+](C)(C)C)OCCCCCCCC/C=C\CCCCCCCC.[Cl-] |
Computed by PubChem (NCBI)