Products 868594-57-4

CAS 868594-57-4 is the registry number for N-(1-(2,3-Dioleyloxy)propyl)-N,N,N-Trimethylammonium Iodide. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2,3-bis[(Z)-octadec-9-enoxy]propyl-trimethylazanium chloride (CAS 868594-57-4) is a chemical compound with the molecular formula C42H84ClNO2 and a molecular weight of 670.6 g/mol. IUPAC name: 2,3-bis[(Z)-octadec-9-enoxy]propyl-trimethylazanium chloride. InChIKey: LDGWQMRUWMSZIU-LQDDAWAPSA-M.

Identity
Molecular formulaC42H84ClNO2
Molecular weight670.6 g/mol
IUPAC name2,3-bis[(Z)-octadec-9-enoxy]propyl-trimethylazanium chloride
InChIKeyLDGWQMRUWMSZIU-LQDDAWAPSA-M
SMILESCCCCCCCC/C=C\CCCCCCCCOCC(C[N+](C)(C)C)OCCCCCCCC/C=C\CCCCCCCC.[Cl-]

Computed by PubChem (NCBI)