CAS 104182-09-4 appears in our catalog under these names: 4,4-Dimethyl retinoic acid, 98%, 4,4-Dimethyl Retinoic Acid, 4,4-Dimethyl retinoic acid, 95.67%. Offered by: Chemat Brand, TRC, MedChemExpress. Available pack sizes: on request, 0,5mg, 2,5mg, 500 μg, 1 mg, 2.5 mg.
(2E,4E,6E,8E)-3,7-dimethyl-9-(2,3,3,6,6-pentamethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoic acid (CAS 104182-09-4) is a chemical compound with the molecular formula C22H32O2 and a molecular weight of 328.5 g/mol. IUPAC name: (2E,4E,6E,8E)-3,7-dimethyl-9-(2,3,3,6,6-pentamethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoic acid. InChIKey: XRAHVFWRNAIIPG-ZYXNGHQDSA-N.
| Molecular formula | C22H32O2 |
|---|---|
| Molecular weight | 328.5 g/mol |
| IUPAC name | (2E,4E,6E,8E)-3,7-dimethyl-9-(2,3,3,6,6-pentamethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoic acid |
| InChIKey | XRAHVFWRNAIIPG-ZYXNGHQDSA-N |
| SMILES | CC1=C(C(CCC1(C)C)(C)C)/C=C/C(=C/C=C/C(=C/C(=O)O)/C)/C |
Computed by PubChem (NCBI)