CAS 29444-27-7 appears in our catalog under these names: 9,13-cis,cis Vitamin A, 9-Cis,13-cis-retinol 15-acetate. Offered by: Chemat Brand, Biosynth. Available pack sizes: on request, 5mg, 1mg, 10mg, 25mg, 50mg.
[(2Z,4E,6Z,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenyl] acetate (CAS 29444-27-7) is a chemical compound with the molecular formula C22H32O2 and a molecular weight of 328.5 g/mol. IUPAC name: [(2Z,4E,6Z,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenyl] acetate. InChIKey: QGNJRVVDBSJHIZ-VEKRBDQFSA-N.
| Molecular formula | C22H32O2 |
|---|---|
| Molecular weight | 328.5 g/mol |
| IUPAC name | [(2Z,4E,6Z,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenyl] acetate |
| InChIKey | QGNJRVVDBSJHIZ-VEKRBDQFSA-N |
| SMILES | CC1=C(C(CCC1)(C)C)/C=C/C(=C\C=C\C(=C/COC(=O)C)\C)/C |
Computed by PubChem (NCBI)